NAVIGATION
QUICK INQUIRY
What is the molecular formula of 2-Octyldodecyl heptanoate?
The molecular formula of 2-Octyldodecyl heptanoate is C27H54O2.
What is the molecular weight of 2-Octyldodecyl heptanoate?
The molecular weight of 2-Octyldodecyl heptanoate is 410.7 g/mol.
What is the IUPAC name for 2-Octyldodecyl heptanoate?
The IUPAC name for 2-Octyldodecyl heptanoate is 2-octyldodecyl heptanoate.
What is the InChI of 2-Octyldodecyl heptanoate?
The InChI of 2-Octyldodecyl heptanoate is InChI=1S/C27H54O2/c1-4-7-10-13-15-16-18-20-23-26(22-19-17-14-11-8-5-2)25-29-27(28)24-21-12-9-6-3/h26H,4-25H2,1-3H3.
What is the InChIKey of 2-Octyldodecyl heptanoate?
The InChIKey of 2-Octyldodecyl heptanoate is CJSAUJNKQOIYJQ-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Octyldodecyl heptanoate?
The canonical SMILES representation of 2-Octyldodecyl heptanoate is CCCCCCCCCCC(CCCCCCCC)COC(=O)CCCCCC.
How many hydrogen bond donor counts are in 2-Octyldodecyl heptanoate?
There are 0 hydrogen bond donor counts in 2-Octyldodecyl heptanoate.
How many rotatable bond counts are in 2-Octyldodecyl heptanoate?
There are 24 rotatable bond counts in 2-Octyldodecyl heptanoate.
What is the exact mass of 2-Octyldodecyl heptanoate?
The exact mass of 2-Octyldodecyl heptanoate is 410.412380961 g/mol.
Is 2-Octyldodecyl heptanoate considered canonicalized in terms of compound structure?
Yes, 2-Octyldodecyl heptanoate is considered canonicalized in terms of compound structure.
CAS: 94266-37-2
Bis-(heptadecanoato-o)hydroxyaluminum
CAS: 94266-38-3
Hydroxybis(pentadecanoato-o)aluminum
CAS: 94266-39-4
CAS: 94278-07-6
CAS: 94278-13-4
[6,11-Dioxo-3-[[(1-oxooctyl)oxy]methyl]-1,5-dioxacycloundec-3-yl]methyl decanoate
CAS: 94278-17-8